Benzenemethanamine, 2,4,5-trifluoro- (9CI)
2,4,5-TRIFLUOROBENZYL AMINE
CAS: 168644-93-7
Molecular Formula: C7H6F3N
Benzenemethanamine, 2,4,5-trifluoro- (9CI) - Names and Identifiers
| Name | 2,4,5-TRIFLUOROBENZYL AMINE |
| Synonyms | 2,4,5-trifluorobenzylamine 2,4,5-TRIFLUOROBENZYL AMINE (2,4,5-Trifluorophenyl)methylamine 1-(2,4,5-TRIFLUOROPHENYL)METHANAMINE Benzenemethanamine, 2,4,5-trifluoro- Benzenemethanamine, 2,4,5-trifluoro- (9CI) |
| CAS | 168644-93-7 |
| InChI | InChI=1/C7H6F3N/c8-5-2-7(10)6(9)1-4(5)3-11/h1-2H,3,11H2 |
Benzenemethanamine, 2,4,5-trifluoro- (9CI) - Physico-chemical Properties
| Molecular Formula | C7H6F3N |
| Molar Mass | 161.12 |
| Density | 1.320 |
| Melting Point | 274-275℃ |
| Boling Point | 55°C/1mm |
| Flash Point | 55°C/1mm |
| Vapor Presure | 1.08mmHg at 25°C |
| pKa | 8.32±0.10(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Sensitive | Air Sensitive |
| Refractive Index | 1.48 |
| MDL | MFCD00236316 |
| Physical and Chemical Properties | Sensitivity: Air Sensitive |
Benzenemethanamine, 2,4,5-trifluoro- (9CI) - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| UN IDs | UN2735 |
| Hazard Class | 8 |
| Packing Group | III |
Benzenemethanamine, 2,4,5-trifluoro- (9CI) - Introduction
2,4,5-TRIFLUOROBENZYL AMINE is an organic compound with a chemical formula of C7H6F3N and a molecular weight of 161.12g/mol. The following is an introduction to the nature, use, preparation and safety information of 2,4,5-TRIFLUOROBENZYL AMINE:
Nature:
1. Appearance: 2,4,5-TRIFLUOROBENZYL AMINE is a colorless or pale yellow liquid.
2. Solubility: it is soluble in organic solvents such as ethanol, ether and dichloromethane, insoluble in water.
3. Melting point and boiling point: The melting point of the compound is -35 ° C, and the boiling point is 152 ° C.
4. Stability: 2,4,5-TRIFLUOROBENZYL AMINE is relatively stable to light and heat, but may decompose under strong acid or alkali conditions.
Use:
1. Pesticide: 2,4,5-TRIFLUOROBENZYL AMINE can be used as an insecticide and herbicide to control pests and weeds in agricultural fields.
2. Medicine: It may also be used to develop intermediates for pesticides and drugs.
3. Laboratory research: Because it is an organic compound, 2,4,5-TRIFLUOROBENZYL AMINE is also used in scientific research and laboratory synthesis.
Method:
2,4,5-TRIFLUOROBENZYL AMINE can be prepared by reacting 2,4, 5-triaminobenzoic acid with boron trifluoride to generate 2,4, 5-triaminobenzyl, and then react with three fluorine formaldehyde to obtain the target product. The specific preparation steps need to be carried out under suitable laboratory conditions and require suitable chemicals and equipment.
Safety Information:
1. 2,4,5-TRIFLUOROBENZYL AMINE may be harmful and direct contact with skin, eyes and respiratory system should be avoided.
2. Use should follow the necessary personal protective measures, such as wearing protective gloves and goggles.
3. Waste shall be disposed in compliance with local environmental regulations and sent to a suitable treatment facility for disposal.
Please note that this is only a brief introduction to 2,4,5-TRIFLUOROBENZYL AMINE. If you have specific applications or safety issues, please consult a chemical expert or refer to relevant literature.
Nature:
1. Appearance: 2,4,5-TRIFLUOROBENZYL AMINE is a colorless or pale yellow liquid.
2. Solubility: it is soluble in organic solvents such as ethanol, ether and dichloromethane, insoluble in water.
3. Melting point and boiling point: The melting point of the compound is -35 ° C, and the boiling point is 152 ° C.
4. Stability: 2,4,5-TRIFLUOROBENZYL AMINE is relatively stable to light and heat, but may decompose under strong acid or alkali conditions.
Use:
1. Pesticide: 2,4,5-TRIFLUOROBENZYL AMINE can be used as an insecticide and herbicide to control pests and weeds in agricultural fields.
2. Medicine: It may also be used to develop intermediates for pesticides and drugs.
3. Laboratory research: Because it is an organic compound, 2,4,5-TRIFLUOROBENZYL AMINE is also used in scientific research and laboratory synthesis.
Method:
2,4,5-TRIFLUOROBENZYL AMINE can be prepared by reacting 2,4, 5-triaminobenzoic acid with boron trifluoride to generate 2,4, 5-triaminobenzyl, and then react with three fluorine formaldehyde to obtain the target product. The specific preparation steps need to be carried out under suitable laboratory conditions and require suitable chemicals and equipment.
Safety Information:
1. 2,4,5-TRIFLUOROBENZYL AMINE may be harmful and direct contact with skin, eyes and respiratory system should be avoided.
2. Use should follow the necessary personal protective measures, such as wearing protective gloves and goggles.
3. Waste shall be disposed in compliance with local environmental regulations and sent to a suitable treatment facility for disposal.
Please note that this is only a brief introduction to 2,4,5-TRIFLUOROBENZYL AMINE. If you have specific applications or safety issues, please consult a chemical expert or refer to relevant literature.
Last Update：2024-04-09 21:04:16
Supplier List
Product Name: 2,4,5-Trifluorobenzylamine Visit Supplier Webpage Request for quotation
CAS: 168644-93-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 168644-93-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 2,4,5-Trifluorobenzylamine Visit Supplier Webpage Request for quotation
CAS: 168644-93-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 168644-93-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History